C23H23N5O4 — CID 136755003
(7R)-7-(1,3-benzodioxol-5-yl)-2-ethyl-N-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136755003) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is (7R)-7-(1,3-benzodioxol-5-yl)-2-ethyl-N-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-7-(1,3-benzodioxol-5-yl)-2-ethyl-N-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136755003 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | (7R)-7-(1,3-benzodioxol-5-yl)-2-ethyl-N-(2-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCc1nc2n(n1)[C@H](c1ccc3c(c1)OCO3)C(C(=O)Nc1ccccc1OC)=C(C)N2 |
| InChI | InChI=1S/C23H23N5O4/c1-4-19-26-23-24-13(2)20(22(29)25-15-7-5-6-8-16(15)30-3)21(28(23)27-19)14-9-10-17-18(11-14)32-12-31-17/h5-11,21H,4,12H2,1-3H3,(H,25,29)(H,24,26,27)/t21-/m1/s1 |
| InChIKey | JLLOXFSLRHECJW-OAQYLSRUSA-N |
| XLogP | 3.51 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |