C22H21N5O3 — CID 135651819
7-(1,3-benzodioxol-5-yl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135651819) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-yl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(1,3-benzodioxol-5-yl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135651819 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 7-(1,3-benzodioxol-5-yl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)C(c2ccc3c(c2)OCO3)n2ncnc2N1 |
| InChI | InChI=1S/C22H21N5O3/c1-12-4-6-16(13(2)8-12)26-21(28)19-14(3)25-22-23-10-24-27(22)20(19)15-5-7-17-18(9-15)30-11-29-17/h4-10,20H,11H2,1-3H3,(H,26,28)(H,23,24,25) |
| InChIKey | FSETUBQDNZXMMM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |