C30H26O8S — CID 1217551
[3-(3,4-dimethylphenyl)sulfonyl-4-(3-methoxybenzoyl)oxyphenyl] 3-methoxybenzoate (PubChem CID 1217551) has the molecular formula C30H26O8S and a molecular weight of 546.60 g/mol. Its IUPAC name is [3-(3,4-dimethylphenyl)sulfonyl-4-(3-methoxybenzoyl)oxyphenyl] 3-methoxybenzoate.
| Compound Name | [3-(3,4-dimethylphenyl)sulfonyl-4-(3-methoxybenzoyl)oxyphenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 1217551 |
| Molecular Formula | C30H26O8S |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | [3-(3,4-dimethylphenyl)sulfonyl-4-(3-methoxybenzoyl)oxyphenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(OC(=O)c3cccc(OC)c3)c(S(=O)(=O)c3ccc(C)c(C)c3)c2)c1 |
| InChI | InChI=1S/C30H26O8S/c1-19-11-13-26(15-20(19)2)39(33,34)28-18-25(37-29(31)21-7-5-9-23(16-21)35-3)12-14-27(28)38-30(32)22-8-6-10-24(17-22)36-4/h5-18H,1-4H3 |
| InChIKey | PNXIZXANFVICCU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|