About 2-acetyloxypropyl acetate
2-acetyloxypropyl acetate (PubChem CID 12198) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is 2-acetyloxypropyl acetate.
Molecular Properties
| Compound Name | 2-acetyloxypropyl acetate |
| PubChem CID | 12198 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 2-acetyloxypropyl acetate |
| SMILES | CC(=O)OCC(C)OC(C)=O |
| InChI | InChI=1S/C7H12O4/c1-5(11-7(3)9)4-10-6(2)8/h5H,4H2,1-3H3 |
| InChIKey | MLHOXUWWKVQEJB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-acetyloxypropyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxypropyl acetate?
The IUPAC name of 2-acetyloxypropyl acetate (CID 12198) is 2-acetyloxypropyl acetate.
What is the SMILES notation for 2-acetyloxypropyl acetate?
The canonical SMILES for 2-acetyloxypropyl acetate is CC(=O)OCC(C)OC(C)=O.
What is the InChIKey of 2-acetyloxypropyl acetate?
The InChIKey is MLHOXUWWKVQEJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c1-5(11-7(3)9)4-10-6(2)8/h5H,4H2,1-3H3.
What are the key properties of 2-acetyloxypropyl acetate?
2-acetyloxypropyl acetate has a molecular weight of 160.17 g/mol, XLogP of 0.50, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxypropyl acetate is sourced from PubChem (CID 12198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).