C12H19N3O3S — CID 122004240
4-[2-(5-ethyl-1,3-thiazol-2-yl)ethylcarbamoylamino]butanoic acid (PubChem CID 122004240) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 4-[2-(5-ethyl-1,3-thiazol-2-yl)ethylcarbamoylamino]butanoic acid.
| Compound Name | 4-[2-(5-ethyl-1,3-thiazol-2-yl)ethylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122004240 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 4-[2-(5-ethyl-1,3-thiazol-2-yl)ethylcarbamoylamino]butanoic acid |
| SMILES | CCc1cnc(CCNC(=O)NCCCC(=O)O)s1 |
| InChI | InChI=1S/C12H19N3O3S/c1-2-9-8-15-10(19-9)5-7-14-12(18)13-6-3-4-11(16)17/h8H,2-7H2,1H3,(H,16,17)(H2,13,14,18) |
| InChIKey | IXOPJUKCANRCSJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|