C16H18F3N3O5 — CID 122005269
(3S,4S)-1-[1-(4-methyl-3-nitrophenyl)ethylcarbamoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 122005269) has the molecular formula C16H18F3N3O5 and a molecular weight of 389.33 g/mol. Its IUPAC name is (3S,4S)-1-[1-(4-methyl-3-nitrophenyl)ethylcarbamoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-[1-(4-methyl-3-nitrophenyl)ethylcarbamoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122005269 |
| Molecular Formula | C16H18F3N3O5 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | (3S,4S)-1-[1-(4-methyl-3-nitrophenyl)ethylcarbamoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | Cc1ccc(C(C)NC(=O)N2C[C@@H](C(F)(F)F)[C@H](C(=O)O)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18F3N3O5/c1-8-3-4-10(5-13(8)22(26)27)9(2)20-15(25)21-6-11(14(23)24)12(7-21)16(17,18)19/h3-5,9,11-12H,6-7H2,1-2H3,(H,20,25)(H,23,24)/t9?,11-,12-/m1/s1 |
| InChIKey | MAVLCXKZCVFUJB-JZXPMDSESA-N |
| XLogP | 2.87 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|