C17H28N4O3 — CID 122008999
4-[3-(1,3,5-trimethylpyrazol-4-yl)propylcarbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122008999) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-[3-(1,3,5-trimethylpyrazol-4-yl)propylcarbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[3-(1,3,5-trimethylpyrazol-4-yl)propylcarbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122008999 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 4-[3-(1,3,5-trimethylpyrazol-4-yl)propylcarbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | Cc1nn(C)c(C)c1CCCNC(=O)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C17H28N4O3/c1-11-15(12(2)21(3)20-11)5-4-10-18-17(24)19-14-8-6-13(7-9-14)16(22)23/h13-14H,4-10H2,1-3H3,(H,22,23)(H2,18,19,24) |
| InChIKey | DVVLGKFQCQBZDY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|