About 3-[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]cyclopentane-1-carboxylic acid
3-[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 66031336) has the molecular formula C14H21N3O3
and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]cyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]cyclopentane-1-carboxylic acid |
| PubChem CID | 66031336 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 3-[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | Cc1nn(C)c(C)c1CC(=O)NC1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C14H21N3O3/c1-8-12(9(2)17(3)16-8)7-13(18)15-11-5-4-10(6-11)14(19)20/h10-11H,4-7H2,1-3H3,(H,15,18)(H,19,20) |
| InChIKey | PVFKPKYARUHQJU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]cyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]cyclopentane-1-carboxylic acid?
The IUPAC name of 3-[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]cyclopentane-1-carboxylic acid (CID 66031336) is 3-[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]cyclopentane-1-carboxylic acid.
What is the SMILES notation for 3-[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]cyclopentane-1-carboxylic acid?
The canonical SMILES for 3-[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]cyclopentane-1-carboxylic acid is Cc1nn(C)c(C)c1CC(=O)NC1CCC(C(=O)O)C1.
What is the InChIKey of 3-[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]cyclopentane-1-carboxylic acid?
The InChIKey is PVFKPKYARUHQJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O3/c1-8-12(9(2)17(3)16-8)7-13(18)15-11-5-4-10(6-11)14(19)20/h10-11H,4-7H2,1-3H3,(H,15,18)(H,19,20).
What are the key properties of 3-[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]cyclopentane-1-carboxylic acid?
3-[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]cyclopentane-1-carboxylic acid has a molecular weight of 279.34 g/mol, XLogP of 0.95, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]cyclopentane-1-carboxylic acid is sourced from PubChem (CID 66031336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).