C15H21N3O3 — CID 106319981
cis-(1R,3S)-3-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 106319981) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is cis-(1R,3S)-3-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106319981 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | cis-(1R,3S)-3-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | Cc1nn(C)c(C)c1/C=C/C(=O)N[C@H]1CC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C15H21N3O3/c1-9-13(10(2)18(3)17-9)6-7-14(19)16-12-5-4-11(8-12)15(20)21/h6-7,11-12H,4-5,8H2,1-3H3,(H,16,19)(H,20,21)/b7-6+/t11-,12+/m1/s1 |
| InChIKey | FCPDLIWWQSFQPS-JIVBQCDMSA-N |
| XLogP | 1.42 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|