C20H26N4O3 — CID 122009669
4-[[3-(2-tert-butylpyrimidin-4-yl)propylcarbamoylamino]methyl]benzoic acid (PubChem CID 122009669) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-[[3-(2-tert-butylpyrimidin-4-yl)propylcarbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[3-(2-tert-butylpyrimidin-4-yl)propylcarbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122009669 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 4-[[3-(2-tert-butylpyrimidin-4-yl)propylcarbamoylamino]methyl]benzoic acid |
| SMILES | CC(C)(C)c1nccc(CCCNC(=O)NCc2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C20H26N4O3/c1-20(2,3)18-21-12-10-16(24-18)5-4-11-22-19(27)23-13-14-6-8-15(9-7-14)17(25)26/h6-10,12H,4-5,11,13H2,1-3H3,(H,25,26)(H2,22,23,27) |
| InChIKey | USZGMMDBMWRJSN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|