C22H29N7O — CID 166212786
N-[3-(2-tert-butylpyrimidin-4-yl)propyl]-4-(6-cyano-2-pyridinyl)piperazine-1-carboxamide (PubChem CID 166212786) has the molecular formula C22H29N7O and a molecular weight of 407.52 g/mol. Its IUPAC name is N-[3-(2-tert-butylpyrimidin-4-yl)propyl]-4-(6-cyano-2-pyridinyl)piperazine-1-carboxamide.
| Compound Name | N-[3-(2-tert-butylpyrimidin-4-yl)propyl]-4-(6-cyano-2-pyridinyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 166212786 |
| Molecular Formula | C22H29N7O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | N-[3-(2-tert-butylpyrimidin-4-yl)propyl]-4-(6-cyano-2-pyridinyl)piperazine-1-carboxamide |
| SMILES | CC(C)(C)c1nccc(CCCNC(=O)N2CCN(c3cccc(C#N)n3)CC2)n1 |
| InChI | InChI=1S/C22H29N7O/c1-22(2,3)20-24-11-9-17(27-20)7-5-10-25-21(30)29-14-12-28(13-15-29)19-8-4-6-18(16-23)26-19/h4,6,8-9,11H,5,7,10,12-15H2,1-3H3,(H,25,30) |
| InChIKey | GEEMCFXWZQZALC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|