C17H24N2O3S — CID 122012389
5-phenyl-4-(thiolan-3-ylmethylcarbamoylamino)pentanoic acid (PubChem CID 122012389) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is 5-phenyl-4-(thiolan-3-ylmethylcarbamoylamino)pentanoic acid.
| Compound Name | 5-phenyl-4-(thiolan-3-ylmethylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 122012389 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 5-phenyl-4-(thiolan-3-ylmethylcarbamoylamino)pentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NC(=O)NCC1CCSC1 |
| InChI | InChI=1S/C17H24N2O3S/c20-16(21)7-6-15(10-13-4-2-1-3-5-13)19-17(22)18-11-14-8-9-23-12-14/h1-5,14-15H,6-12H2,(H,20,21)(H2,18,19,22) |
| InChIKey | AHGIIEDWXONIEG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |