C11H13Br2N3O3 — CID 122016016
4-[(3,5-dibromo-4-pyridinyl)methylcarbamoylamino]butanoic acid (PubChem CID 122016016) has the molecular formula C11H13Br2N3O3 and a molecular weight of 395.05 g/mol. Its IUPAC name is 4-[(3,5-dibromo-4-pyridinyl)methylcarbamoylamino]butanoic acid.
| Compound Name | 4-[(3,5-dibromo-4-pyridinyl)methylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122016016 |
| Molecular Formula | C11H13Br2N3O3 |
| Molecular Weight | 395.05 g/mol |
| Exact Mass | 392.93 |
| IUPAC Name | 4-[(3,5-dibromo-4-pyridinyl)methylcarbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)NCc1c(Br)cncc1Br |
| InChI | InChI=1S/C11H13Br2N3O3/c12-8-5-14-6-9(13)7(8)4-16-11(19)15-3-1-2-10(17)18/h5-6H,1-4H2,(H,17,18)(H2,15,16,19) |
| InChIKey | DJMZDHLKIJPCAD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.05 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|