C18H26N2O4 — CID 122016468
4-[[(2-propan-2-yloxan-4-yl)methylcarbamoylamino]methyl]benzoic acid (PubChem CID 122016468) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-[[(2-propan-2-yloxan-4-yl)methylcarbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[(2-propan-2-yloxan-4-yl)methylcarbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122016468 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 4-[[(2-propan-2-yloxan-4-yl)methylcarbamoylamino]methyl]benzoic acid |
| SMILES | CC(C)C1CC(CNC(=O)NCc2ccc(C(=O)O)cc2)CCO1 |
| InChI | InChI=1S/C18H26N2O4/c1-12(2)16-9-14(7-8-24-16)11-20-18(23)19-10-13-3-5-15(6-4-13)17(21)22/h3-6,12,14,16H,7-11H2,1-2H3,(H,21,22)(H2,19,20,23) |
| InChIKey | SCUNZFBAEXLZMK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |