C17H24N2O4 — CID 122017118
4-[[(2,2-dimethyloxan-4-yl)methylcarbamoylamino]methyl]benzoic acid (PubChem CID 122017118) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 4-[[(2,2-dimethyloxan-4-yl)methylcarbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[(2,2-dimethyloxan-4-yl)methylcarbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122017118 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 4-[[(2,2-dimethyloxan-4-yl)methylcarbamoylamino]methyl]benzoic acid |
| SMILES | CC1(C)CC(CNC(=O)NCc2ccc(C(=O)O)cc2)CCO1 |
| InChI | InChI=1S/C17H24N2O4/c1-17(2)9-13(7-8-23-17)11-19-16(22)18-10-12-3-5-14(6-4-12)15(20)21/h3-6,13H,7-11H2,1-2H3,(H,20,21)(H2,18,19,22) |
| InChIKey | KQEMTZLSCSCTFV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |