C13H25N3O5 — CID 122018058
3-[[(2S)-1-(2-methoxyethylamino)-4-methyl-1-oxopentan-2-yl]carbamoylamino]propanoic acid (PubChem CID 122018058) has the molecular formula C13H25N3O5 and a molecular weight of 303.36 g/mol. Its IUPAC name is 3-[[(2S)-1-(2-methoxyethylamino)-4-methyl-1-oxopentan-2-yl]carbamoylamino]propanoic acid.
| Compound Name | 3-[[(2S)-1-(2-methoxyethylamino)-4-methyl-1-oxopentan-2-yl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 122018058 |
| Molecular Formula | C13H25N3O5 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 3-[[(2S)-1-(2-methoxyethylamino)-4-methyl-1-oxopentan-2-yl]carbamoylamino]propanoic acid |
| SMILES | COCCNC(=O)[C@H](CC(C)C)NC(=O)NCCC(=O)O |
| InChI | InChI=1S/C13H25N3O5/c1-9(2)8-10(12(19)14-6-7-21-3)16-13(20)15-5-4-11(17)18/h9-10H,4-8H2,1-3H3,(H,14,19)(H,17,18)(H2,15,16,20)/t10-/m0/s1 |
| InChIKey | LCKCKXMOXCKOBA-JTQLQIEISA-N |
| XLogP | -0.06 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|