3-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]propanoic acid

C10H18N2O3S — CID 122018365

IUPAC3-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]propanoic acid
SMILESCC1CCN(C(=O)NCCC(=O)O)CCS1
InChIInChI=1S/C10H18N2O3S/c1-8-3-5-12(6-7-16-8)10(15)11-4-2-9(13)14/h8H,2-7H2,1H3,(H,11,15)(H,13,14)
InChIKeyOYBKDWUNJIWJEK-UHFFFAOYSA-N
MW246.33 g/mol
LogP1.00
Rot. Bonds3

About 3-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]propanoic acid

3-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]propanoic acid (PubChem CID 122018365) has the molecular formula C10H18N2O3S and a molecular weight of 246.33 g/mol. Its IUPAC name is 3-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]propanoic acid.

Molecular Properties

Compound Name3-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]propanoic acid
PubChem CID122018365
Molecular FormulaC10H18N2O3S
Molecular Weight246.33 g/mol
Exact Mass246.10
IUPAC Name3-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]propanoic acid
SMILESCC1CCN(C(=O)NCCC(=O)O)CCS1
InChIInChI=1S/C10H18N2O3S/c1-8-3-5-12(6-7-16-8)10(15)11-4-2-9(13)14/h8H,2-7H2,1H3,(H,11,15)(H,13,14)
InChIKeyOYBKDWUNJIWJEK-UHFFFAOYSA-N
XLogP1.00
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.33
LogP ≤ 51.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]propanoic acid?
The IUPAC name of 3-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]propanoic acid (CID 122018365) is 3-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]propanoic acid.
What is the SMILES notation for 3-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]propanoic acid?
The canonical SMILES for 3-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]propanoic acid is CC1CCN(C(=O)NCCC(=O)O)CCS1.
What is the InChIKey of 3-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]propanoic acid?
The InChIKey is OYBKDWUNJIWJEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O3S/c1-8-3-5-12(6-7-16-8)10(15)11-4-2-9(13)14/h8H,2-7H2,1H3,(H,11,15)(H,13,14).
What are the key properties of 3-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]propanoic acid?
3-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]propanoic acid has a molecular weight of 246.33 g/mol, XLogP of 1.00, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]propanoic acid is sourced from PubChem (CID 122018365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).