About 3-[(1,1-dioxo-1,4-thiazinane-4-carbonyl)amino]propanoic acid
3-[(1,1-dioxo-1,4-thiazinane-4-carbonyl)amino]propanoic acid (PubChem CID 61203101) has the molecular formula C8H14N2O5S
and a molecular weight of 250.28 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,4-thiazinane-4-carbonyl)amino]propanoic acid.
Analyze 3-[(1,1-dioxo-1,4-thiazinane-4-carbonyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,1-dioxo-1,4-thiazinane-4-carbonyl)amino]propanoic acid?
The IUPAC name of 3-[(1,1-dioxo-1,4-thiazinane-4-carbonyl)amino]propanoic acid (CID 61203101) is 3-[(1,1-dioxo-1,4-thiazinane-4-carbonyl)amino]propanoic acid.
What is the SMILES notation for 3-[(1,1-dioxo-1,4-thiazinane-4-carbonyl)amino]propanoic acid?
The canonical SMILES for 3-[(1,1-dioxo-1,4-thiazinane-4-carbonyl)amino]propanoic acid is O=C(O)CCNC(=O)N1CCS(=O)(=O)CC1.
What is the InChIKey of 3-[(1,1-dioxo-1,4-thiazinane-4-carbonyl)amino]propanoic acid?
The InChIKey is XZYRUSPBWLXVEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O5S/c11-7(12)1-2-9-8(13)10-3-5-16(14,15)6-4-10/h1-6H2,(H,9,13)(H,11,12).
What are the key properties of 3-[(1,1-dioxo-1,4-thiazinane-4-carbonyl)amino]propanoic acid?
3-[(1,1-dioxo-1,4-thiazinane-4-carbonyl)amino]propanoic acid has a molecular weight of 250.28 g/mol, XLogP of -1.10, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxo-1,4-thiazinane-4-carbonyl)amino]propanoic acid is sourced from PubChem (CID 61203101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).