3-[(4,4-diethylazepane-1-carbonyl)amino]propanoic acid

C14H26N2O3 — CID 122018412

IUPAC3-[(4,4-diethylazepane-1-carbonyl)amino]propanoic acid
SMILESCCC1(CC)CCCN(C(=O)NCCC(=O)O)CC1
InChIInChI=1S/C14H26N2O3/c1-3-14(4-2)7-5-10-16(11-8-14)13(19)15-9-6-12(17)18/h3-11H2,1-2H3,(H,15,19)(H,17,18)
InChIKeyHJGJVMPYSCQMHM-UHFFFAOYSA-N
MW270.37 g/mol
LogP2.46
Rot. Bonds5

About 3-[(4,4-diethylazepane-1-carbonyl)amino]propanoic acid

3-[(4,4-diethylazepane-1-carbonyl)amino]propanoic acid (PubChem CID 122018412) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 3-[(4,4-diethylazepane-1-carbonyl)amino]propanoic acid.

Molecular Properties

Compound Name3-[(4,4-diethylazepane-1-carbonyl)amino]propanoic acid
PubChem CID122018412
Molecular FormulaC14H26N2O3
Molecular Weight270.37 g/mol
Exact Mass270.19
IUPAC Name3-[(4,4-diethylazepane-1-carbonyl)amino]propanoic acid
SMILESCCC1(CC)CCCN(C(=O)NCCC(=O)O)CC1
InChIInChI=1S/C14H26N2O3/c1-3-14(4-2)7-5-10-16(11-8-14)13(19)15-9-6-12(17)18/h3-11H2,1-2H3,(H,15,19)(H,17,18)
InChIKeyHJGJVMPYSCQMHM-UHFFFAOYSA-N
XLogP2.46
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.37
LogP ≤ 52.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-[(4,4-diethylazepane-1-carbonyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(4,4-diethylazepane-1-carbonyl)amino]propanoic acid?
The IUPAC name of 3-[(4,4-diethylazepane-1-carbonyl)amino]propanoic acid (CID 122018412) is 3-[(4,4-diethylazepane-1-carbonyl)amino]propanoic acid.
What is the SMILES notation for 3-[(4,4-diethylazepane-1-carbonyl)amino]propanoic acid?
The canonical SMILES for 3-[(4,4-diethylazepane-1-carbonyl)amino]propanoic acid is CCC1(CC)CCCN(C(=O)NCCC(=O)O)CC1.
What is the InChIKey of 3-[(4,4-diethylazepane-1-carbonyl)amino]propanoic acid?
The InChIKey is HJGJVMPYSCQMHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O3/c1-3-14(4-2)7-5-10-16(11-8-14)13(19)15-9-6-12(17)18/h3-11H2,1-2H3,(H,15,19)(H,17,18).
What are the key properties of 3-[(4,4-diethylazepane-1-carbonyl)amino]propanoic acid?
3-[(4,4-diethylazepane-1-carbonyl)amino]propanoic acid has a molecular weight of 270.37 g/mol, XLogP of 2.46, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,4-diethylazepane-1-carbonyl)amino]propanoic acid is sourced from PubChem (CID 122018412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).