4-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]butanoic acid

C11H20N2O3 — CID 63219024

IUPAC4-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]butanoic acid
SMILESCC1(C)CCCN1C(=O)NCCCC(=O)O
InChIInChI=1S/C11H20N2O3/c1-11(2)6-4-8-13(11)10(16)12-7-3-5-9(14)15/h3-8H2,1-2H3,(H,12,16)(H,14,15)
InChIKeyLNNORUQCANLMGI-UHFFFAOYSA-N
MW228.29 g/mol
LogP1.44
Rot. Bonds4

About 4-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]butanoic acid

4-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]butanoic acid (PubChem CID 63219024) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 4-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]butanoic acid.

Molecular Properties

Compound Name4-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]butanoic acid
PubChem CID63219024
Molecular FormulaC11H20N2O3
Molecular Weight228.29 g/mol
Exact Mass228.15
IUPAC Name4-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]butanoic acid
SMILESCC1(C)CCCN1C(=O)NCCCC(=O)O
InChIInChI=1S/C11H20N2O3/c1-11(2)6-4-8-13(11)10(16)12-7-3-5-9(14)15/h3-8H2,1-2H3,(H,12,16)(H,14,15)
InChIKeyLNNORUQCANLMGI-UHFFFAOYSA-N
XLogP1.44
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.29
LogP ≤ 51.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]butanoic acid?
The IUPAC name of 4-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]butanoic acid (CID 63219024) is 4-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]butanoic acid.
What is the SMILES notation for 4-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]butanoic acid?
The canonical SMILES for 4-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]butanoic acid is CC1(C)CCCN1C(=O)NCCCC(=O)O.
What is the InChIKey of 4-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]butanoic acid?
The InChIKey is LNNORUQCANLMGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3/c1-11(2)6-4-8-13(11)10(16)12-7-3-5-9(14)15/h3-8H2,1-2H3,(H,12,16)(H,14,15).
What are the key properties of 4-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]butanoic acid?
4-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]butanoic acid has a molecular weight of 228.29 g/mol, XLogP of 1.44, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]butanoic acid is sourced from PubChem (CID 63219024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).