C11H18N2O6S — CID 43581886
6-[(1,1-dioxo-1,4-thiazinane-4-carbonyl)amino]-6-oxohexanoic acid (PubChem CID 43581886) has the molecular formula C11H18N2O6S and a molecular weight of 306.34 g/mol. Its IUPAC name is 6-[(1,1-dioxo-1,4-thiazinane-4-carbonyl)amino]-6-oxohexanoic acid.
| Compound Name | 6-[(1,1-dioxo-1,4-thiazinane-4-carbonyl)amino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 43581886 |
| Molecular Formula | C11H18N2O6S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 6-[(1,1-dioxo-1,4-thiazinane-4-carbonyl)amino]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)NC(=O)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H18N2O6S/c14-9(3-1-2-4-10(15)16)12-11(17)13-5-7-20(18,19)8-6-13/h1-8H2,(H,15,16)(H,12,14,17) |
| InChIKey | PNBBEDFJPMIATI-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|