C12H17N3O5 — CID 79680359
6-[(2-cyanomorpholine-4-carbonyl)amino]-6-oxohexanoic acid (PubChem CID 79680359) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 6-[(2-cyanomorpholine-4-carbonyl)amino]-6-oxohexanoic acid.
| Compound Name | 6-[(2-cyanomorpholine-4-carbonyl)amino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 79680359 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 6-[(2-cyanomorpholine-4-carbonyl)amino]-6-oxohexanoic acid |
| SMILES | N#CC1CN(C(=O)NC(=O)CCCCC(=O)O)CCO1 |
| InChI | InChI=1S/C12H17N3O5/c13-7-9-8-15(5-6-20-9)12(19)14-10(16)3-1-2-4-11(17)18/h9H,1-6,8H2,(H,17,18)(H,14,16,19) |
| InChIKey | WCNBSMLKWZRADX-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|