C14H21N3O4 — CID 79671135
4-[[(2-cyanomorpholine-4-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 79671135) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is 4-[[(2-cyanomorpholine-4-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(2-cyanomorpholine-4-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79671135 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 4-[[(2-cyanomorpholine-4-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | N#CC1CN(C(=O)NCC2CCC(C(=O)O)CC2)CCO1 |
| InChI | InChI=1S/C14H21N3O4/c15-7-12-9-17(5-6-21-12)14(20)16-8-10-1-3-11(4-2-10)13(18)19/h10-12H,1-6,8-9H2,(H,16,20)(H,18,19) |
| InChIKey | CALABZXTLJRCQR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |