C12H19N3O4 — CID 81070191
3-[[(2-cyanomorpholine-4-carbonyl)amino]methyl]pentanoic acid (PubChem CID 81070191) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-[[(2-cyanomorpholine-4-carbonyl)amino]methyl]pentanoic acid.
| Compound Name | 3-[[(2-cyanomorpholine-4-carbonyl)amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 81070191 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-[[(2-cyanomorpholine-4-carbonyl)amino]methyl]pentanoic acid |
| SMILES | CCC(CNC(=O)N1CCOC(C#N)C1)CC(=O)O |
| InChI | InChI=1S/C12H19N3O4/c1-2-9(5-11(16)17)7-14-12(18)15-3-4-19-10(6-13)8-15/h9-10H,2-5,7-8H2,1H3,(H,14,18)(H,16,17) |
| InChIKey | XXOQECXPUOYNAC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |