5-(morpholine-4-carbonylamino)-5-oxopentanoic acid

C10H16N2O5 — CID 28931672

IUPAC5-(morpholine-4-carbonylamino)-5-oxopentanoic acid
SMILESO=C(O)CCCC(=O)NC(=O)N1CCOCC1
InChIInChI=1S/C10H16N2O5/c13-8(2-1-3-9(14)15)11-10(16)12-4-6-17-7-5-12/h1-7H2,(H,14,15)(H,11,13,16)
InChIKeyFPVAWZOSLVTWRH-UHFFFAOYSA-N
MW244.25 g/mol
LogP-0.19
Rot. Bonds4

About 5-(morpholine-4-carbonylamino)-5-oxopentanoic acid

5-(morpholine-4-carbonylamino)-5-oxopentanoic acid (PubChem CID 28931672) has the molecular formula C10H16N2O5 and a molecular weight of 244.25 g/mol. Its IUPAC name is 5-(morpholine-4-carbonylamino)-5-oxopentanoic acid.

Molecular Properties

Compound Name5-(morpholine-4-carbonylamino)-5-oxopentanoic acid
PubChem CID28931672
Molecular FormulaC10H16N2O5
Molecular Weight244.25 g/mol
Exact Mass244.11
IUPAC Name5-(morpholine-4-carbonylamino)-5-oxopentanoic acid
SMILESO=C(O)CCCC(=O)NC(=O)N1CCOCC1
InChIInChI=1S/C10H16N2O5/c13-8(2-1-3-9(14)15)11-10(16)12-4-6-17-7-5-12/h1-7H2,(H,14,15)(H,11,13,16)
InChIKeyFPVAWZOSLVTWRH-UHFFFAOYSA-N
XLogP-0.19
TPSA95.94 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.25
LogP ≤ 5-0.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-(morpholine-4-carbonylamino)-5-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

N-(4-aminobutanoyl)morpholine-4-carboxamide
CID 82509016
6-oxo-6-(piperidine-1-carbonylamino)hexanoic acid
CID 43447360
N-(3-chloropropanoyl)-1,4-oxazepane-4-carboxamide
CID 62966590
6-[(1,1-dioxo-1,4-thiazinane-4-carbonyl)amino]-6-oxohexanoic acid
CID 43581886
6-oxo-6-[(4-propan-2-ylpiperazine-1-carbonyl)amino]hexanoic acid
CID 43585543
6-[(2-cyanomorpholine-4-carbonyl)amino]-6-oxohexanoic acid
CID 79680359
5-[[4-(methoxymethyl)piperidine-1-carbonyl]amino]-5-oxopentanoic acid
CID 63978254
4-[(4-acetylpiperazine-1-carbonyl)amino]-4-oxobutanoic acid
CID 28746387
6-[(2,6-dimethylmorpholine-4-carbonyl)amino]-6-oxohexanoic acid
CID 43447293
2-(morpholine-4-carbonylamino)acetic acid
CID 18917961
N-acetylmorpholine-4-carboxamide
CID 102407930
5-[(3-ethyl-4-methylpiperazine-1-carbonyl)amino]-5-oxopentanoic acid
CID 63621909

Frequently Asked Questions

What is the IUPAC name of 5-(morpholine-4-carbonylamino)-5-oxopentanoic acid?
The IUPAC name of 5-(morpholine-4-carbonylamino)-5-oxopentanoic acid (CID 28931672) is 5-(morpholine-4-carbonylamino)-5-oxopentanoic acid.
What is the SMILES notation for 5-(morpholine-4-carbonylamino)-5-oxopentanoic acid?
The canonical SMILES for 5-(morpholine-4-carbonylamino)-5-oxopentanoic acid is O=C(O)CCCC(=O)NC(=O)N1CCOCC1.
What is the InChIKey of 5-(morpholine-4-carbonylamino)-5-oxopentanoic acid?
The InChIKey is FPVAWZOSLVTWRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O5/c13-8(2-1-3-9(14)15)11-10(16)12-4-6-17-7-5-12/h1-7H2,(H,14,15)(H,11,13,16).
What are the key properties of 5-(morpholine-4-carbonylamino)-5-oxopentanoic acid?
5-(morpholine-4-carbonylamino)-5-oxopentanoic acid has a molecular weight of 244.25 g/mol, XLogP of -0.19, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(morpholine-4-carbonylamino)-5-oxopentanoic acid is sourced from PubChem (CID 28931672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).