3-[(6-cyclobutyl-1,4-oxazepane-4-carbonyl)amino]propanoic acid

C13H22N2O4 — CID 122018918

IUPAC3-[(6-cyclobutyl-1,4-oxazepane-4-carbonyl)amino]propanoic acid
SMILESO=C(O)CCNC(=O)N1CCOCC(C2CCC2)C1
InChIInChI=1S/C13H22N2O4/c16-12(17)4-5-14-13(18)15-6-7-19-9-11(8-15)10-2-1-3-10/h10-11H,1-9H2,(H,14,18)(H,16,17)
InChIKeyIZOVTIBDATVISZ-UHFFFAOYSA-N
MW270.33 g/mol
LogP0.92
Rot. Bonds4

About 3-[(6-cyclobutyl-1,4-oxazepane-4-carbonyl)amino]propanoic acid

3-[(6-cyclobutyl-1,4-oxazepane-4-carbonyl)amino]propanoic acid (PubChem CID 122018918) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-[(6-cyclobutyl-1,4-oxazepane-4-carbonyl)amino]propanoic acid.

Molecular Properties

Compound Name3-[(6-cyclobutyl-1,4-oxazepane-4-carbonyl)amino]propanoic acid
PubChem CID122018918
Molecular FormulaC13H22N2O4
Molecular Weight270.33 g/mol
Exact Mass270.16
IUPAC Name3-[(6-cyclobutyl-1,4-oxazepane-4-carbonyl)amino]propanoic acid
SMILESO=C(O)CCNC(=O)N1CCOCC(C2CCC2)C1
InChIInChI=1S/C13H22N2O4/c16-12(17)4-5-14-13(18)15-6-7-19-9-11(8-15)10-2-1-3-10/h10-11H,1-9H2,(H,14,18)(H,16,17)
InChIKeyIZOVTIBDATVISZ-UHFFFAOYSA-N
XLogP0.92
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.33
LogP ≤ 50.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-[(6-cyclobutyl-1,4-oxazepane-4-carbonyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(6-cyclobutyl-1,4-oxazepane-4-carbonyl)amino]propanoic acid?
The IUPAC name of 3-[(6-cyclobutyl-1,4-oxazepane-4-carbonyl)amino]propanoic acid (CID 122018918) is 3-[(6-cyclobutyl-1,4-oxazepane-4-carbonyl)amino]propanoic acid.
What is the SMILES notation for 3-[(6-cyclobutyl-1,4-oxazepane-4-carbonyl)amino]propanoic acid?
The canonical SMILES for 3-[(6-cyclobutyl-1,4-oxazepane-4-carbonyl)amino]propanoic acid is O=C(O)CCNC(=O)N1CCOCC(C2CCC2)C1.
What is the InChIKey of 3-[(6-cyclobutyl-1,4-oxazepane-4-carbonyl)amino]propanoic acid?
The InChIKey is IZOVTIBDATVISZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O4/c16-12(17)4-5-14-13(18)15-6-7-19-9-11(8-15)10-2-1-3-10/h10-11H,1-9H2,(H,14,18)(H,16,17).
What are the key properties of 3-[(6-cyclobutyl-1,4-oxazepane-4-carbonyl)amino]propanoic acid?
3-[(6-cyclobutyl-1,4-oxazepane-4-carbonyl)amino]propanoic acid has a molecular weight of 270.33 g/mol, XLogP of 0.92, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-cyclobutyl-1,4-oxazepane-4-carbonyl)amino]propanoic acid is sourced from PubChem (CID 122018918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).