C15H19N3O4 — CID 122018967
3-[[2-[(4-cyanophenyl)methoxy]ethyl-methylcarbamoyl]amino]propanoic acid (PubChem CID 122018967) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 3-[[2-[(4-cyanophenyl)methoxy]ethyl-methylcarbamoyl]amino]propanoic acid.
| Compound Name | 3-[[2-[(4-cyanophenyl)methoxy]ethyl-methylcarbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122018967 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3-[[2-[(4-cyanophenyl)methoxy]ethyl-methylcarbamoyl]amino]propanoic acid |
| SMILES | CN(CCOCc1ccc(C#N)cc1)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C15H19N3O4/c1-18(15(21)17-7-6-14(19)20)8-9-22-11-13-4-2-12(10-16)3-5-13/h2-5H,6-9,11H2,1H3,(H,17,21)(H,19,20) |
| InChIKey | GBRHDKRLDYIUJB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|