C16H21N3O4 — CID 122020376
4-[[(3-oxo-4-propan-2-ylpiperazine-1-carbonyl)amino]methyl]benzoic acid (PubChem CID 122020376) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 4-[[(3-oxo-4-propan-2-ylpiperazine-1-carbonyl)amino]methyl]benzoic acid.
| Compound Name | 4-[[(3-oxo-4-propan-2-ylpiperazine-1-carbonyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122020376 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 4-[[(3-oxo-4-propan-2-ylpiperazine-1-carbonyl)amino]methyl]benzoic acid |
| SMILES | CC(C)N1CCN(C(=O)NCc2ccc(C(=O)O)cc2)CC1=O |
| InChI | InChI=1S/C16H21N3O4/c1-11(2)19-8-7-18(10-14(19)20)16(23)17-9-12-3-5-13(6-4-12)15(21)22/h3-6,11H,7-10H2,1-2H3,(H,17,23)(H,21,22) |
| InChIKey | ITOHZSABPQMZLE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |