C19H22N4O4 — CID 122020591
4-[[[2-methoxyethyl-[(1-prop-2-ynylpyrazol-3-yl)methyl]carbamoyl]amino]methyl]benzoic acid (PubChem CID 122020591) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 4-[[[2-methoxyethyl-[(1-prop-2-ynylpyrazol-3-yl)methyl]carbamoyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[2-methoxyethyl-[(1-prop-2-ynylpyrazol-3-yl)methyl]carbamoyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122020591 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 4-[[[2-methoxyethyl-[(1-prop-2-ynylpyrazol-3-yl)methyl]carbamoyl]amino]methyl]benzoic acid |
| SMILES | C#CCn1ccc(CN(CCOC)C(=O)NCc2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C19H22N4O4/c1-3-9-23-10-8-17(21-23)14-22(11-12-27-2)19(26)20-13-15-4-6-16(7-5-15)18(24)25/h1,4-8,10H,9,11-14H2,2H3,(H,20,26)(H,24,25) |
| InChIKey | BGIWJAMNKZSHON-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|