C22H22N4O2 — CID 129036255
3-[[4-[[bis(prop-2-ynyl)carbamoylamino]methyl]phenyl]methyl]-1,1-bis(prop-2-ynyl)urea (PubChem CID 129036255) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3-[[4-[[bis(prop-2-ynyl)carbamoylamino]methyl]phenyl]methyl]-1,1-bis(prop-2-ynyl)urea.
| Compound Name | 3-[[4-[[bis(prop-2-ynyl)carbamoylamino]methyl]phenyl]methyl]-1,1-bis(prop-2-ynyl)urea |
|---|---|
| PubChem CID | 129036255 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 3-[[4-[[bis(prop-2-ynyl)carbamoylamino]methyl]phenyl]methyl]-1,1-bis(prop-2-ynyl)urea |
| SMILES | C#CCN(CC#C)C(=O)NCc1ccc(CNC(=O)N(CC#C)CC#C)cc1 |
| InChI | InChI=1S/C22H22N4O2/c1-5-13-25(14-6-2)21(27)23-17-19-9-11-20(12-10-19)18-24-22(28)26(15-7-3)16-8-4/h1-4,9-12H,13-18H2,(H,23,27)(H,24,28) |
| InChIKey | ODODTHUGZSKXQG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|