C17H17FN4O — CID 51097336
1-[(4-fluorophenyl)methyl]-3-[(2-methylpyrimidin-4-yl)methyl]-1-prop-2-ynylurea (PubChem CID 51097336) has the molecular formula C17H17FN4O and a molecular weight of 312.35 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[(2-methylpyrimidin-4-yl)methyl]-1-prop-2-ynylurea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[(2-methylpyrimidin-4-yl)methyl]-1-prop-2-ynylurea |
|---|---|
| PubChem CID | 51097336 |
| Molecular Formula | C17H17FN4O |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[(2-methylpyrimidin-4-yl)methyl]-1-prop-2-ynylurea |
| SMILES | C#CCN(Cc1ccc(F)cc1)C(=O)NCc1ccnc(C)n1 |
| InChI | InChI=1S/C17H17FN4O/c1-3-10-22(12-14-4-6-15(18)7-5-14)17(23)20-11-16-8-9-19-13(2)21-16/h1,4-9H,10-12H2,2H3,(H,20,23) |
| InChIKey | IMBSPBHZVHCNMF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|