C22H27NO3 — CID 122029806
4-[3-(3-hydroxy-3-phenylpropyl)anilino]cyclohexane-1-carboxylic acid (PubChem CID 122029806) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 4-[3-(3-hydroxy-3-phenylpropyl)anilino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[3-(3-hydroxy-3-phenylpropyl)anilino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122029806 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 4-[3-(3-hydroxy-3-phenylpropyl)anilino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(Nc2cccc(CCC(O)c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C22H27NO3/c24-21(17-6-2-1-3-7-17)14-9-16-5-4-8-20(15-16)23-19-12-10-18(11-13-19)22(25)26/h1-8,15,18-19,21,23-24H,9-14H2,(H,25,26) |
| InChIKey | RPSVTVHNSFNWAA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |