C18H30N2O2 — CID 122030222
4-[[[2-(diethylamino)-4-methylpentyl]amino]methyl]benzoic acid (PubChem CID 122030222) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 4-[[[2-(diethylamino)-4-methylpentyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[2-(diethylamino)-4-methylpentyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122030222 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 4-[[[2-(diethylamino)-4-methylpentyl]amino]methyl]benzoic acid |
| SMILES | CCN(CC)C(CNCc1ccc(C(=O)O)cc1)CC(C)C |
| InChI | InChI=1S/C18H30N2O2/c1-5-20(6-2)17(11-14(3)4)13-19-12-15-7-9-16(10-8-15)18(21)22/h7-10,14,17,19H,5-6,11-13H2,1-4H3,(H,21,22) |
| InChIKey | KTZGEZKPDMMSOS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |