C19H22N2O4 — CID 122031287
3-[[[2-(oxan-4-yloxy)-4-pyridinyl]methylamino]methyl]benzoic acid (PubChem CID 122031287) has the molecular formula C19H22N2O4 and a molecular weight of 342.39 g/mol. Its IUPAC name is 3-[[[2-(oxan-4-yloxy)-4-pyridinyl]methylamino]methyl]benzoic acid.
| Compound Name | 3-[[[2-(oxan-4-yloxy)-4-pyridinyl]methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122031287 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3-[[[2-(oxan-4-yloxy)-4-pyridinyl]methylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNCc2ccnc(OC3CCOCC3)c2)c1 |
| InChI | InChI=1S/C19H22N2O4/c22-19(23)16-3-1-2-14(10-16)12-20-13-15-4-7-21-18(11-15)25-17-5-8-24-9-6-17/h1-4,7,10-11,17,20H,5-6,8-9,12-13H2,(H,22,23) |
| InChIKey | XUAKYRVHUHODKD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |