C16H27NO2 — CID 122035113
4-[(1-prop-2-enylcyclopentyl)methylamino]cyclohexane-1-carboxylic acid (PubChem CID 122035113) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 4-[(1-prop-2-enylcyclopentyl)methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(1-prop-2-enylcyclopentyl)methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122035113 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 4-[(1-prop-2-enylcyclopentyl)methylamino]cyclohexane-1-carboxylic acid |
| SMILES | C=CCC1(CNC2CCC(C(=O)O)CC2)CCCC1 |
| InChI | InChI=1S/C16H27NO2/c1-2-9-16(10-3-4-11-16)12-17-14-7-5-13(6-8-14)15(18)19/h2,13-14,17H,1,3-12H2,(H,18,19) |
| InChIKey | JBLDPNMRZWSLJI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|