C21H40N2O3 — CID 159175696
4-(propan-2-ylamino)cyclohexane-1-carboxylic acid;1-[4-(propan-2-ylamino)cyclohexyl]ethenol (PubChem CID 159175696) has the molecular formula C21H40N2O3 and a molecular weight of 368.56 g/mol. Its IUPAC name is 4-(propan-2-ylamino)cyclohexane-1-carboxylic acid;1-[4-(propan-2-ylamino)cyclohexyl]ethenol.
| Compound Name | 4-(propan-2-ylamino)cyclohexane-1-carboxylic acid;1-[4-(propan-2-ylamino)cyclohexyl]ethenol |
|---|---|
| PubChem CID | 159175696 |
| Molecular Formula | C21H40N2O3 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.30 |
| IUPAC Name | 4-(propan-2-ylamino)cyclohexane-1-carboxylic acid;1-[4-(propan-2-ylamino)cyclohexyl]ethenol |
| SMILES | C=C(O)C1CCC(NC(C)C)CC1.CC(C)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C11H21NO.C10H19NO2/c1-8(2)12-11-6-4-10(5-7-11)9(3)13;1-7(2)11-9-5-3-8(4-6-9)10(12)13/h8,10-13H,3-7H2,1-2H3;7-9,11H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | KMGBOPUOMFADSX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|