C21H40N2O2 — CID 160793218
4-(tert-butylamino)cyclohexane-1-carboxylic acid;N-tert-butylcyclohex-3-en-1-amine (PubChem CID 160793218) has the molecular formula C21H40N2O2 and a molecular weight of 352.56 g/mol. Its IUPAC name is 4-(tert-butylamino)cyclohexane-1-carboxylic acid;N-tert-butylcyclohex-3-en-1-amine.
| Compound Name | 4-(tert-butylamino)cyclohexane-1-carboxylic acid;N-tert-butylcyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 160793218 |
| Molecular Formula | C21H40N2O2 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | 4-(tert-butylamino)cyclohexane-1-carboxylic acid;N-tert-butylcyclohex-3-en-1-amine |
| SMILES | CC(C)(C)NC1CC=CCC1.CC(C)(C)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C11H21NO2.C10H19N/c1-11(2,3)12-9-6-4-8(5-7-9)10(13)14;1-10(2,3)11-9-7-5-4-6-8-9/h8-9,12H,4-7H2,1-3H3,(H,13,14);4-5,9,11H,6-8H2,1-3H3 |
| InChIKey | SCCDPTRUQUUQMV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|