C17H22BrNO4 — CID 122036622
1-[(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 122036622) has the molecular formula C17H22BrNO4 and a molecular weight of 384.27 g/mol. Its IUPAC name is 1-[(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122036622 |
| Molecular Formula | C17H22BrNO4 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 1-[(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | C=CCOc1c(Br)cc(CN2CCCC2C(=O)O)cc1OCC |
| InChI | InChI=1S/C17H22BrNO4/c1-3-8-23-16-13(18)9-12(10-15(16)22-4-2)11-19-7-5-6-14(19)17(20)21/h3,9-10,14H,1,4-8,11H2,2H3,(H,20,21) |
| InChIKey | YIOSVXHUBFGHFO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|