C21H22F3NO2 — CID 122037539
(2S)-3-phenyl-2-[[3-[4-(trifluoromethyl)phenyl]cyclopentyl]amino]propanoic acid (PubChem CID 122037539) has the molecular formula C21H22F3NO2 and a molecular weight of 377.41 g/mol. Its IUPAC name is (2S)-3-phenyl-2-[[3-[4-(trifluoromethyl)phenyl]cyclopentyl]amino]propanoic acid.
| Compound Name | (2S)-3-phenyl-2-[[3-[4-(trifluoromethyl)phenyl]cyclopentyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122037539 |
| Molecular Formula | C21H22F3NO2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (2S)-3-phenyl-2-[[3-[4-(trifluoromethyl)phenyl]cyclopentyl]amino]propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1)NC1CCC(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C21H22F3NO2/c22-21(23,24)17-9-6-15(7-10-17)16-8-11-18(13-16)25-19(20(26)27)12-14-4-2-1-3-5-14/h1-7,9-10,16,18-19,25H,8,11-13H2,(H,26,27)/t16?,18?,19-/m0/s1 |
| InChIKey | HQQULQJHOGZILW-KVZIAJEVSA-N |
| XLogP | 4.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |