C18H20BrNO3 — CID 122037769
(2R)-2-[1-(2-bromo-4-methoxyphenyl)ethylamino]-3-phenylpropanoic acid (PubChem CID 122037769) has the molecular formula C18H20BrNO3 and a molecular weight of 378.27 g/mol. Its IUPAC name is (2R)-2-[1-(2-bromo-4-methoxyphenyl)ethylamino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[1-(2-bromo-4-methoxyphenyl)ethylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 122037769 |
| Molecular Formula | C18H20BrNO3 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | (2R)-2-[1-(2-bromo-4-methoxyphenyl)ethylamino]-3-phenylpropanoic acid |
| SMILES | COc1ccc(C(C)N[C@H](Cc2ccccc2)C(=O)O)c(Br)c1 |
| InChI | InChI=1S/C18H20BrNO3/c1-12(15-9-8-14(23-2)11-16(15)19)20-17(18(21)22)10-13-6-4-3-5-7-13/h3-9,11-12,17,20H,10H2,1-2H3,(H,21,22)/t12?,17-/m1/s1 |
| InChIKey | OVLJVUWTUWSXCF-RGUGMKFQSA-N |
| XLogP | 3.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |