C15H21BrN2O3S — CID 122039411
2-[2-acetamidoethyl-[(4-bromo-2-methylsulfanylphenyl)methyl]amino]propanoic acid (PubChem CID 122039411) has the molecular formula C15H21BrN2O3S and a molecular weight of 389.32 g/mol. Its IUPAC name is 2-[2-acetamidoethyl-[(4-bromo-2-methylsulfanylphenyl)methyl]amino]propanoic acid.
| Compound Name | 2-[2-acetamidoethyl-[(4-bromo-2-methylsulfanylphenyl)methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122039411 |
| Molecular Formula | C15H21BrN2O3S |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 2-[2-acetamidoethyl-[(4-bromo-2-methylsulfanylphenyl)methyl]amino]propanoic acid |
| SMILES | CSc1cc(Br)ccc1CN(CCNC(C)=O)C(C)C(=O)O |
| InChI | InChI=1S/C15H21BrN2O3S/c1-10(15(20)21)18(7-6-17-11(2)19)9-12-4-5-13(16)8-14(12)22-3/h4-5,8,10H,6-7,9H2,1-3H3,(H,17,19)(H,20,21) |
| InChIKey | JQIXJUUDLPXELX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |