C14H18BrClN2O3 — CID 122039148
2-[2-acetamidoethyl-[(2-bromo-4-chlorophenyl)methyl]amino]propanoic acid (PubChem CID 122039148) has the molecular formula C14H18BrClN2O3 and a molecular weight of 377.67 g/mol. Its IUPAC name is 2-[2-acetamidoethyl-[(2-bromo-4-chlorophenyl)methyl]amino]propanoic acid.
| Compound Name | 2-[2-acetamidoethyl-[(2-bromo-4-chlorophenyl)methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122039148 |
| Molecular Formula | C14H18BrClN2O3 |
| Molecular Weight | 377.67 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 2-[2-acetamidoethyl-[(2-bromo-4-chlorophenyl)methyl]amino]propanoic acid |
| SMILES | CC(=O)NCCN(Cc1ccc(Cl)cc1Br)C(C)C(=O)O |
| InChI | InChI=1S/C14H18BrClN2O3/c1-9(14(20)21)18(6-5-17-10(2)19)8-11-3-4-12(16)7-13(11)15/h3-4,7,9H,5-6,8H2,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | HGFPVWAKCUCQPO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.67 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |