C17H24ClN3O5 — CID 122120519
2-[2-acetamidoethyl-[3-(5-chloro-2-methoxyanilino)-3-oxopropyl]amino]propanoic acid (PubChem CID 122120519) has the molecular formula C17H24ClN3O5 and a molecular weight of 385.85 g/mol. Its IUPAC name is 2-[2-acetamidoethyl-[3-(5-chloro-2-methoxyanilino)-3-oxopropyl]amino]propanoic acid.
| Compound Name | 2-[2-acetamidoethyl-[3-(5-chloro-2-methoxyanilino)-3-oxopropyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122120519 |
| Molecular Formula | C17H24ClN3O5 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-[2-acetamidoethyl-[3-(5-chloro-2-methoxyanilino)-3-oxopropyl]amino]propanoic acid |
| SMILES | COc1ccc(Cl)cc1NC(=O)CCN(CCNC(C)=O)C(C)C(=O)O |
| InChI | InChI=1S/C17H24ClN3O5/c1-11(17(24)25)21(9-7-19-12(2)22)8-6-16(23)20-14-10-13(18)4-5-15(14)26-3/h4-5,10-11H,6-9H2,1-3H3,(H,19,22)(H,20,23)(H,24,25) |
| InChIKey | LQUIUTCTLAERSZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |