C15H19ClN4O6 — CID 122120587
2-[2-acetamidoethyl-[2-(4-chloro-2-nitroanilino)-2-oxoethyl]amino]propanoic acid (PubChem CID 122120587) has the molecular formula C15H19ClN4O6 and a molecular weight of 386.79 g/mol. Its IUPAC name is 2-[2-acetamidoethyl-[2-(4-chloro-2-nitroanilino)-2-oxoethyl]amino]propanoic acid.
| Compound Name | 2-[2-acetamidoethyl-[2-(4-chloro-2-nitroanilino)-2-oxoethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122120587 |
| Molecular Formula | C15H19ClN4O6 |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-[2-acetamidoethyl-[2-(4-chloro-2-nitroanilino)-2-oxoethyl]amino]propanoic acid |
| SMILES | CC(=O)NCCN(CC(=O)Nc1ccc(Cl)cc1[N+](=O)[O-])C(C)C(=O)O |
| InChI | InChI=1S/C15H19ClN4O6/c1-9(15(23)24)19(6-5-17-10(2)21)8-14(22)18-12-4-3-11(16)7-13(12)20(25)26/h3-4,7,9H,5-6,8H2,1-2H3,(H,17,21)(H,18,22)(H,23,24) |
| InChIKey | NPZOFYJMNAYRGA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 141.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|