C14H20ClN3O4 — CID 111108098
N-(4-chloro-2-nitrophenyl)-2-[2-hydroxypropyl(propan-2-yl)amino]acetamide (PubChem CID 111108098) has the molecular formula C14H20ClN3O4 and a molecular weight of 329.78 g/mol. Its IUPAC name is N-(4-chloro-2-nitrophenyl)-2-[2-hydroxypropyl(propan-2-yl)amino]acetamide.
| Compound Name | N-(4-chloro-2-nitrophenyl)-2-[2-hydroxypropyl(propan-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 111108098 |
| Molecular Formula | C14H20ClN3O4 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | N-(4-chloro-2-nitrophenyl)-2-[2-hydroxypropyl(propan-2-yl)amino]acetamide |
| SMILES | CC(O)CN(CC(=O)Nc1ccc(Cl)cc1[N+](=O)[O-])C(C)C |
| InChI | InChI=1S/C14H20ClN3O4/c1-9(2)17(7-10(3)19)8-14(20)16-12-5-4-11(15)6-13(12)18(21)22/h4-6,9-10,19H,7-8H2,1-3H3,(H,16,20) |
| InChIKey | DVLLKTJHLQIDBL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|