C16H23N3O4S — CID 122120592
2-[2-acetamidoethyl-[2-(3-methylsulfanylanilino)-2-oxoethyl]amino]propanoic acid (PubChem CID 122120592) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is 2-[2-acetamidoethyl-[2-(3-methylsulfanylanilino)-2-oxoethyl]amino]propanoic acid.
| Compound Name | 2-[2-acetamidoethyl-[2-(3-methylsulfanylanilino)-2-oxoethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122120592 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-[2-acetamidoethyl-[2-(3-methylsulfanylanilino)-2-oxoethyl]amino]propanoic acid |
| SMILES | CSc1cccc(NC(=O)CN(CCNC(C)=O)C(C)C(=O)O)c1 |
| InChI | InChI=1S/C16H23N3O4S/c1-11(16(22)23)19(8-7-17-12(2)20)10-15(21)18-13-5-4-6-14(9-13)24-3/h4-6,9,11H,7-8,10H2,1-3H3,(H,17,20)(H,18,21)(H,22,23) |
| InChIKey | LRUGSIKOJXIGCS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |