C18H28ClNO2 — CID 122039602
2-[[1-(3-chlorophenyl)-4-methylpentan-2-yl]amino]hexanoic acid (PubChem CID 122039602) has the molecular formula C18H28ClNO2 and a molecular weight of 325.88 g/mol. Its IUPAC name is 2-[[1-(3-chlorophenyl)-4-methylpentan-2-yl]amino]hexanoic acid.
| Compound Name | 2-[[1-(3-chlorophenyl)-4-methylpentan-2-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 122039602 |
| Molecular Formula | C18H28ClNO2 |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-[[1-(3-chlorophenyl)-4-methylpentan-2-yl]amino]hexanoic acid |
| SMILES | CCCCC(NC(Cc1cccc(Cl)c1)CC(C)C)C(=O)O |
| InChI | InChI=1S/C18H28ClNO2/c1-4-5-9-17(18(21)22)20-16(10-13(2)3)12-14-7-6-8-15(19)11-14/h6-8,11,13,16-17,20H,4-5,9-10,12H2,1-3H3,(H,21,22) |
| InChIKey | MBZNMSLNODEWBI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |