C19H30ClNO2 — CID 122127902
2-[[[1-(3-chlorophenyl)-4-methylpentan-2-yl]amino]methyl]-4-methylpentanoic acid (PubChem CID 122127902) has the molecular formula C19H30ClNO2 and a molecular weight of 339.91 g/mol. Its IUPAC name is 2-[[[1-(3-chlorophenyl)-4-methylpentan-2-yl]amino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[[1-(3-chlorophenyl)-4-methylpentan-2-yl]amino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122127902 |
| Molecular Formula | C19H30ClNO2 |
| Molecular Weight | 339.91 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 2-[[[1-(3-chlorophenyl)-4-methylpentan-2-yl]amino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(Cc1cccc(Cl)c1)NCC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C19H30ClNO2/c1-13(2)8-16(19(22)23)12-21-18(9-14(3)4)11-15-6-5-7-17(20)10-15/h5-7,10,13-14,16,18,21H,8-9,11-12H2,1-4H3,(H,22,23) |
| InChIKey | RJSLRBIXQYZVHW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.91 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |