C20H30N2O2 — CID 122039605
2-[(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)amino]hexanoic acid (PubChem CID 122039605) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 2-[(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)amino]hexanoic acid.
| Compound Name | 2-[(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 122039605 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 2-[(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)amino]hexanoic acid |
| SMILES | CCCCC(NC1CC2CCC(C1)N2Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H30N2O2/c1-2-3-9-19(20(23)24)21-16-12-17-10-11-18(13-16)22(17)14-15-7-5-4-6-8-15/h4-8,16-19,21H,2-3,9-14H2,1H3,(H,23,24) |
| InChIKey | UFZPPZBFRZYVFL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |