C20H26ClN3O2 — CID 122040617
1-[[1-tert-butyl-3-(2-chlorophenyl)pyrazol-4-yl]methyl]piperidine-3-carboxylic acid (PubChem CID 122040617) has the molecular formula C20H26ClN3O2 and a molecular weight of 375.90 g/mol. Its IUPAC name is 1-[[1-tert-butyl-3-(2-chlorophenyl)pyrazol-4-yl]methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[[1-tert-butyl-3-(2-chlorophenyl)pyrazol-4-yl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122040617 |
| Molecular Formula | C20H26ClN3O2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 1-[[1-tert-butyl-3-(2-chlorophenyl)pyrazol-4-yl]methyl]piperidine-3-carboxylic acid |
| SMILES | CC(C)(C)n1cc(CN2CCCC(C(=O)O)C2)c(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C20H26ClN3O2/c1-20(2,3)24-13-15(12-23-10-6-7-14(11-23)19(25)26)18(22-24)16-8-4-5-9-17(16)21/h4-5,8-9,13-14H,6-7,10-12H2,1-3H3,(H,25,26) |
| InChIKey | HKSMAVDAJLQIBD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |